C16H17N7O5S — CID 19265766
ethyl 4,5-dimethyl-2-[[1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carbonyl]amino]thiophene-3-carboxylate (PubChem CID 19265766) has the molecular formula C16H17N7O5S and a molecular weight of 419.42 g/mol. Its IUPAC name is ethyl 4,5-dimethyl-2-[[1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carbonyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4,5-dimethyl-2-[[1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carbonyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19265766 |
| Molecular Formula | C16H17N7O5S |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | ethyl 4,5-dimethyl-2-[[1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carbonyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccn(Cn3cnc([N+](=O)[O-])n3)n2)sc(C)c1C |
| InChI | InChI=1S/C16H17N7O5S/c1-4-28-15(25)12-9(2)10(3)29-14(12)18-13(24)11-5-6-21(19-11)8-22-7-17-16(20-22)23(26)27/h5-7H,4,8H2,1-3H3,(H,18,24) |
| InChIKey | DTCAKQPINOZQQF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 147.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|