C22H21FN4O8S — CID 19280469
diethyl 5-[[1-[(5-fluoro-2-nitrophenoxy)methyl]pyrazole-3-carbonyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 19280469) has the molecular formula C22H21FN4O8S and a molecular weight of 520.50 g/mol. Its IUPAC name is diethyl 5-[[1-[(5-fluoro-2-nitrophenoxy)methyl]pyrazole-3-carbonyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[[1-[(5-fluoro-2-nitrophenoxy)methyl]pyrazole-3-carbonyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 19280469 |
| Molecular Formula | C22H21FN4O8S |
| Molecular Weight | 520.50 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | diethyl 5-[[1-[(5-fluoro-2-nitrophenoxy)methyl]pyrazole-3-carbonyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)c2ccn(COc3cc(F)ccc3[N+](=O)[O-])n2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C22H21FN4O8S/c1-4-33-21(29)17-12(3)18(22(30)34-5-2)36-20(17)24-19(28)14-8-9-26(25-14)11-35-16-10-13(23)6-7-15(16)27(31)32/h6-10H,4-5,11H2,1-3H3,(H,24,28) |
| InChIKey | BMHPUAJZTGDDSU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 151.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|