C17H21N5O6S — CID 19557750
ethyl 5-carbamoyl-2-[3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoylamino]-4-methylthiophene-3-carboxylate (PubChem CID 19557750) has the molecular formula C17H21N5O6S and a molecular weight of 423.45 g/mol. Its IUPAC name is ethyl 5-carbamoyl-2-[3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoylamino]-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 5-carbamoyl-2-[3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoylamino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19557750 |
| Molecular Formula | C17H21N5O6S |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | ethyl 5-carbamoyl-2-[3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoylamino]-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CCn2nc(C)c([N+](=O)[O-])c2C)sc(C(N)=O)c1C |
| InChI | InChI=1S/C17H21N5O6S/c1-5-28-17(25)12-8(2)14(15(18)24)29-16(12)19-11(23)6-7-21-10(4)13(22(26)27)9(3)20-21/h5-7H2,1-4H3,(H2,18,24)(H,19,23) |
| InChIKey | XJSOPYYOETWYTN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 159.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|