C15H17N5O7S — CID 19558064
methyl 5-carbamoyl-2-[3-(3-methoxy-4-nitropyrazol-1-yl)propanoylamino]-4-methylthiophene-3-carboxylate (PubChem CID 19558064) has the molecular formula C15H17N5O7S and a molecular weight of 411.40 g/mol. Its IUPAC name is methyl 5-carbamoyl-2-[3-(3-methoxy-4-nitropyrazol-1-yl)propanoylamino]-4-methylthiophene-3-carboxylate.
| Compound Name | methyl 5-carbamoyl-2-[3-(3-methoxy-4-nitropyrazol-1-yl)propanoylamino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19558064 |
| Molecular Formula | C15H17N5O7S |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | methyl 5-carbamoyl-2-[3-(3-methoxy-4-nitropyrazol-1-yl)propanoylamino]-4-methylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CCn2cc([N+](=O)[O-])c(OC)n2)sc(C(N)=O)c1C |
| InChI | InChI=1S/C15H17N5O7S/c1-7-10(15(23)27-3)14(28-11(7)12(16)22)17-9(21)4-5-19-6-8(20(24)25)13(18-19)26-2/h6H,4-5H2,1-3H3,(H2,16,22)(H,17,21) |
| InChIKey | FKDOYDGXMNQWNP-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 168.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|