C15H16BrN5O6S — CID 19567748
ethyl 2-[3-(4-bromo-3-nitropyrazol-1-yl)propanoylamino]-5-carbamoyl-4-methylthiophene-3-carboxylate (PubChem CID 19567748) has the molecular formula C15H16BrN5O6S and a molecular weight of 474.29 g/mol. Its IUPAC name is ethyl 2-[3-(4-bromo-3-nitropyrazol-1-yl)propanoylamino]-5-carbamoyl-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[3-(4-bromo-3-nitropyrazol-1-yl)propanoylamino]-5-carbamoyl-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19567748 |
| Molecular Formula | C15H16BrN5O6S |
| Molecular Weight | 474.29 g/mol |
| Exact Mass | 473.00 |
| IUPAC Name | ethyl 2-[3-(4-bromo-3-nitropyrazol-1-yl)propanoylamino]-5-carbamoyl-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CCn2cc(Br)c([N+](=O)[O-])n2)sc(C(N)=O)c1C |
| InChI | InChI=1S/C15H16BrN5O6S/c1-3-27-15(24)10-7(2)11(12(17)23)28-14(10)18-9(22)4-5-20-6-8(16)13(19-20)21(25)26/h6H,3-5H2,1-2H3,(H2,17,23)(H,18,22) |
| InChIKey | RLRQIQFTJQIZCP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 159.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|