C14H14BrN5O6S — CID 19567762
methyl 2-[3-(4-bromo-3-nitropyrazol-1-yl)propanoylamino]-5-carbamoyl-4-methylthiophene-3-carboxylate (PubChem CID 19567762) has the molecular formula C14H14BrN5O6S and a molecular weight of 460.27 g/mol. Its IUPAC name is methyl 2-[3-(4-bromo-3-nitropyrazol-1-yl)propanoylamino]-5-carbamoyl-4-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-[3-(4-bromo-3-nitropyrazol-1-yl)propanoylamino]-5-carbamoyl-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19567762 |
| Molecular Formula | C14H14BrN5O6S |
| Molecular Weight | 460.27 g/mol |
| Exact Mass | 458.98 |
| IUPAC Name | methyl 2-[3-(4-bromo-3-nitropyrazol-1-yl)propanoylamino]-5-carbamoyl-4-methylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CCn2cc(Br)c([N+](=O)[O-])n2)sc(C(N)=O)c1C |
| InChI | InChI=1S/C14H14BrN5O6S/c1-6-9(14(23)26-2)13(27-10(6)11(16)22)17-8(21)3-4-19-5-7(15)12(18-19)20(24)25/h5H,3-4H2,1-2H3,(H2,16,22)(H,17,21) |
| InChIKey | YWYUJVKCAVINLB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 159.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|