C15H17N5O7S — CID 19528202
methyl 5-carbamoyl-2-[2-(3-methoxy-4-nitropyrazol-1-yl)propanoylamino]-4-methylthiophene-3-carboxylate (PubChem CID 19528202) has the molecular formula C15H17N5O7S and a molecular weight of 411.40 g/mol. Its IUPAC name is methyl 5-carbamoyl-2-[2-(3-methoxy-4-nitropyrazol-1-yl)propanoylamino]-4-methylthiophene-3-carboxylate.
| Compound Name | methyl 5-carbamoyl-2-[2-(3-methoxy-4-nitropyrazol-1-yl)propanoylamino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19528202 |
| Molecular Formula | C15H17N5O7S |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | methyl 5-carbamoyl-2-[2-(3-methoxy-4-nitropyrazol-1-yl)propanoylamino]-4-methylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)C(C)n2cc([N+](=O)[O-])c(OC)n2)sc(C(N)=O)c1C |
| InChI | InChI=1S/C15H17N5O7S/c1-6-9(15(23)27-4)14(28-10(6)11(16)21)17-12(22)7(2)19-5-8(20(24)25)13(18-19)26-3/h5,7H,1-4H3,(H2,16,21)(H,17,22) |
| InChIKey | SQQNPGBCXPYNGB-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 168.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|