C17H21N5O7S — CID 19528182
propyl 5-carbamoyl-2-[2-(3-methoxy-4-nitropyrazol-1-yl)propanoylamino]-4-methylthiophene-3-carboxylate (PubChem CID 19528182) has the molecular formula C17H21N5O7S and a molecular weight of 439.45 g/mol. Its IUPAC name is propyl 5-carbamoyl-2-[2-(3-methoxy-4-nitropyrazol-1-yl)propanoylamino]-4-methylthiophene-3-carboxylate.
| Compound Name | propyl 5-carbamoyl-2-[2-(3-methoxy-4-nitropyrazol-1-yl)propanoylamino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19528182 |
| Molecular Formula | C17H21N5O7S |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | propyl 5-carbamoyl-2-[2-(3-methoxy-4-nitropyrazol-1-yl)propanoylamino]-4-methylthiophene-3-carboxylate |
| SMILES | CCCOC(=O)c1c(NC(=O)C(C)n2cc([N+](=O)[O-])c(OC)n2)sc(C(N)=O)c1C |
| InChI | InChI=1S/C17H21N5O7S/c1-5-6-29-17(25)11-8(2)12(13(18)23)30-16(11)19-14(24)9(3)21-7-10(22(26)27)15(20-21)28-4/h7,9H,5-6H2,1-4H3,(H2,18,23)(H,19,24) |
| InChIKey | IJDOYCQBTOHASB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 168.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|