C16H19N5O7S — CID 19516215
propyl 5-carbamoyl-2-[[2-(3-methoxy-4-nitropyrazol-1-yl)acetyl]amino]-4-methylthiophene-3-carboxylate (PubChem CID 19516215) has the molecular formula C16H19N5O7S and a molecular weight of 425.42 g/mol. Its IUPAC name is propyl 5-carbamoyl-2-[[2-(3-methoxy-4-nitropyrazol-1-yl)acetyl]amino]-4-methylthiophene-3-carboxylate.
| Compound Name | propyl 5-carbamoyl-2-[[2-(3-methoxy-4-nitropyrazol-1-yl)acetyl]amino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19516215 |
| Molecular Formula | C16H19N5O7S |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | propyl 5-carbamoyl-2-[[2-(3-methoxy-4-nitropyrazol-1-yl)acetyl]amino]-4-methylthiophene-3-carboxylate |
| SMILES | CCCOC(=O)c1c(NC(=O)Cn2cc([N+](=O)[O-])c(OC)n2)sc(C(N)=O)c1C |
| InChI | InChI=1S/C16H19N5O7S/c1-4-5-28-16(24)11-8(2)12(13(17)23)29-15(11)18-10(22)7-20-6-9(21(25)26)14(19-20)27-3/h6H,4-5,7H2,1-3H3,(H2,17,23)(H,18,22) |
| InChIKey | CMNKEIUOOWJOLL-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 168.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|