C13H12N6O8 — CID 19516344
2-(3-methoxy-4-nitropyrazol-1-yl)-N-(4-methyl-3,5-dinitrophenyl)acetamide (PubChem CID 19516344) has the molecular formula C13H12N6O8 and a molecular weight of 380.27 g/mol. Its IUPAC name is 2-(3-methoxy-4-nitropyrazol-1-yl)-N-(4-methyl-3,5-dinitrophenyl)acetamide.
| Compound Name | 2-(3-methoxy-4-nitropyrazol-1-yl)-N-(4-methyl-3,5-dinitrophenyl)acetamide |
|---|---|
| PubChem CID | 19516344 |
| Molecular Formula | C13H12N6O8 |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 2-(3-methoxy-4-nitropyrazol-1-yl)-N-(4-methyl-3,5-dinitrophenyl)acetamide |
| SMILES | COc1nn(CC(=O)Nc2cc([N+](=O)[O-])c(C)c([N+](=O)[O-])c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H12N6O8/c1-7-9(17(21)22)3-8(4-10(7)18(23)24)14-12(20)6-16-5-11(19(25)26)13(15-16)27-2/h3-5H,6H2,1-2H3,(H,14,20) |
| InChIKey | LNFBDNOMJLMEGB-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 185.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|