C7H11N5O4 — CID 7018447
3-(3-methoxy-4-nitropyrazol-1-yl)propanehydrazide (PubChem CID 7018447) has the molecular formula C7H11N5O4 and a molecular weight of 229.20 g/mol. Its IUPAC name is 3-(3-methoxy-4-nitropyrazol-1-yl)propanehydrazide.
| Compound Name | 3-(3-methoxy-4-nitropyrazol-1-yl)propanehydrazide |
|---|---|
| PubChem CID | 7018447 |
| Molecular Formula | C7H11N5O4 |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 3-(3-methoxy-4-nitropyrazol-1-yl)propanehydrazide |
| SMILES | COc1nn(CCC(=O)NN)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H11N5O4/c1-16-7-5(12(14)15)4-11(10-7)3-2-6(13)9-8/h4H,2-3,8H2,1H3,(H,9,13) |
| InChIKey | MIQNYJSUOUBBET-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 125.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|