C13H13N5O7 — CID 19558283
N-(2-hydroxy-5-nitrophenyl)-3-(3-methoxy-4-nitropyrazol-1-yl)propanamide (PubChem CID 19558283) has the molecular formula C13H13N5O7 and a molecular weight of 351.28 g/mol. Its IUPAC name is N-(2-hydroxy-5-nitrophenyl)-3-(3-methoxy-4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-(2-hydroxy-5-nitrophenyl)-3-(3-methoxy-4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19558283 |
| Molecular Formula | C13H13N5O7 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | N-(2-hydroxy-5-nitrophenyl)-3-(3-methoxy-4-nitropyrazol-1-yl)propanamide |
| SMILES | COc1nn(CCC(=O)Nc2cc([N+](=O)[O-])ccc2O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H13N5O7/c1-25-13-10(18(23)24)7-16(15-13)5-4-12(20)14-9-6-8(17(21)22)2-3-11(9)19/h2-3,6-7,19H,4-5H2,1H3,(H,14,20) |
| InChIKey | KERTVQCKOILFMR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 162.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|