C12H11N5O6 — CID 19516309
2-(3-methoxy-4-nitropyrazol-1-yl)-N-(2-nitrophenyl)acetamide (PubChem CID 19516309) has the molecular formula C12H11N5O6 and a molecular weight of 321.25 g/mol. Its IUPAC name is 2-(3-methoxy-4-nitropyrazol-1-yl)-N-(2-nitrophenyl)acetamide.
| Compound Name | 2-(3-methoxy-4-nitropyrazol-1-yl)-N-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 19516309 |
| Molecular Formula | C12H11N5O6 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 2-(3-methoxy-4-nitropyrazol-1-yl)-N-(2-nitrophenyl)acetamide |
| SMILES | COc1nn(CC(=O)Nc2ccccc2[N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11N5O6/c1-23-12-10(17(21)22)6-15(14-12)7-11(18)13-8-4-2-3-5-9(8)16(19)20/h2-6H,7H2,1H3,(H,13,18) |
| InChIKey | FMLUICRGSWXKKH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 142.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|