C16H19N9O5 — CID 19516421
4-[[2-(3-methoxy-4-nitropyrazol-1-yl)acetyl]amino]-1-methyl-N-[(1-methylpyrazol-4-yl)methyl]pyrazole-5-carboxamide (PubChem CID 19516421) has the molecular formula C16H19N9O5 and a molecular weight of 417.39 g/mol. Its IUPAC name is 4-[[2-(3-methoxy-4-nitropyrazol-1-yl)acetyl]amino]-1-methyl-N-[(1-methylpyrazol-4-yl)methyl]pyrazole-5-carboxamide.
| Compound Name | 4-[[2-(3-methoxy-4-nitropyrazol-1-yl)acetyl]amino]-1-methyl-N-[(1-methylpyrazol-4-yl)methyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19516421 |
| Molecular Formula | C16H19N9O5 |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 4-[[2-(3-methoxy-4-nitropyrazol-1-yl)acetyl]amino]-1-methyl-N-[(1-methylpyrazol-4-yl)methyl]pyrazole-5-carboxamide |
| SMILES | COc1nn(CC(=O)Nc2cnn(C)c2C(=O)NCc2cnn(C)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H19N9O5/c1-22-7-10(5-18-22)4-17-15(27)14-11(6-19-23(14)2)20-13(26)9-24-8-12(25(28)29)16(21-24)30-3/h5-8H,4,9H2,1-3H3,(H,17,27)(H,20,26) |
| InChIKey | GXXIIHBCOANOCO-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 164.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|