C21H20FN9O5 — CID 19276987
4-[[1-[(5-fluoro-2-nitrophenoxy)methyl]pyrazole-3-carbonyl]amino]-1-methyl-N-[(1-methylpyrazol-4-yl)methyl]pyrazole-5-carboxamide (PubChem CID 19276987) has the molecular formula C21H20FN9O5 and a molecular weight of 497.45 g/mol. Its IUPAC name is 4-[[1-[(5-fluoro-2-nitrophenoxy)methyl]pyrazole-3-carbonyl]amino]-1-methyl-N-[(1-methylpyrazol-4-yl)methyl]pyrazole-5-carboxamide.
| Compound Name | 4-[[1-[(5-fluoro-2-nitrophenoxy)methyl]pyrazole-3-carbonyl]amino]-1-methyl-N-[(1-methylpyrazol-4-yl)methyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19276987 |
| Molecular Formula | C21H20FN9O5 |
| Molecular Weight | 497.45 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 4-[[1-[(5-fluoro-2-nitrophenoxy)methyl]pyrazole-3-carbonyl]amino]-1-methyl-N-[(1-methylpyrazol-4-yl)methyl]pyrazole-5-carboxamide |
| SMILES | Cn1cc(CNC(=O)c2c(NC(=O)c3ccn(COc4cc(F)ccc4[N+](=O)[O-])n3)cnn2C)cn1 |
| InChI | InChI=1S/C21H20FN9O5/c1-28-11-13(9-24-28)8-23-21(33)19-16(10-25-29(19)2)26-20(32)15-5-6-30(27-15)12-36-18-7-14(22)3-4-17(18)31(34)35/h3-7,9-11H,8,12H2,1-2H3,(H,23,33)(H,26,32) |
| InChIKey | XFMTWGUMPONACQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 164.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.45 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|