C23H21FN6O5 — CID 19276974
N-[1-[(2,4-dimethylphenoxy)methyl]pyrazol-4-yl]-1-[(5-fluoro-2-nitrophenoxy)methyl]pyrazole-3-carboxamide (PubChem CID 19276974) has the molecular formula C23H21FN6O5 and a molecular weight of 480.46 g/mol. Its IUPAC name is N-[1-[(2,4-dimethylphenoxy)methyl]pyrazol-4-yl]-1-[(5-fluoro-2-nitrophenoxy)methyl]pyrazole-3-carboxamide.
| Compound Name | N-[1-[(2,4-dimethylphenoxy)methyl]pyrazol-4-yl]-1-[(5-fluoro-2-nitrophenoxy)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19276974 |
| Molecular Formula | C23H21FN6O5 |
| Molecular Weight | 480.46 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | N-[1-[(2,4-dimethylphenoxy)methyl]pyrazol-4-yl]-1-[(5-fluoro-2-nitrophenoxy)methyl]pyrazole-3-carboxamide |
| SMILES | Cc1ccc(OCn2cc(NC(=O)c3ccn(COc4cc(F)ccc4[N+](=O)[O-])n3)cn2)c(C)c1 |
| InChI | InChI=1S/C23H21FN6O5/c1-15-3-6-21(16(2)9-15)34-14-29-12-18(11-25-29)26-23(31)19-7-8-28(27-19)13-35-22-10-17(24)4-5-20(22)30(32)33/h3-12H,13-14H2,1-2H3,(H,26,31) |
| InChIKey | BAEYNGRILHYSRV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 126.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|