C18H20N6O4 — CID 19480845
N-[1-[(2,4-dimethylphenoxy)methyl]pyrazol-4-yl]-1,3-dimethyl-4-nitropyrazole-5-carboxamide (PubChem CID 19480845) has the molecular formula C18H20N6O4 and a molecular weight of 384.40 g/mol. Its IUPAC name is N-[1-[(2,4-dimethylphenoxy)methyl]pyrazol-4-yl]-1,3-dimethyl-4-nitropyrazole-5-carboxamide.
| Compound Name | N-[1-[(2,4-dimethylphenoxy)methyl]pyrazol-4-yl]-1,3-dimethyl-4-nitropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19480845 |
| Molecular Formula | C18H20N6O4 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-[1-[(2,4-dimethylphenoxy)methyl]pyrazol-4-yl]-1,3-dimethyl-4-nitropyrazole-5-carboxamide |
| SMILES | Cc1ccc(OCn2cc(NC(=O)c3c([N+](=O)[O-])c(C)nn3C)cn2)c(C)c1 |
| InChI | InChI=1S/C18H20N6O4/c1-11-5-6-15(12(2)7-11)28-10-23-9-14(8-19-23)20-18(25)17-16(24(26)27)13(3)21-22(17)4/h5-9H,10H2,1-4H3,(H,20,25) |
| InChIKey | SNTOYJWBAAWVDL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 117.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|