C20H24N6O5 — CID 19480779
N-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]-1,3-dimethyl-4-nitropyrazole-5-carboxamide (PubChem CID 19480779) has the molecular formula C20H24N6O5 and a molecular weight of 428.45 g/mol. Its IUPAC name is N-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]-1,3-dimethyl-4-nitropyrazole-5-carboxamide.
| Compound Name | N-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]-1,3-dimethyl-4-nitropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19480779 |
| Molecular Formula | C20H24N6O5 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | N-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]-1,3-dimethyl-4-nitropyrazole-5-carboxamide |
| SMILES | CCOc1ccc(Cn2cc(NC(=O)c3c([N+](=O)[O-])c(C)nn3C)cn2)cc1OCC |
| InChI | InChI=1S/C20H24N6O5/c1-5-30-16-8-7-14(9-17(16)31-6-2)11-25-12-15(10-21-25)22-20(27)19-18(26(28)29)13(3)23-24(19)4/h7-10,12H,5-6,11H2,1-4H3,(H,22,27) |
| InChIKey | RBXAUUHLZZCSNE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 126.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|