C21H23F3N6O5 — CID 19524372
N-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]-2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 19524372) has the molecular formula C21H23F3N6O5 and a molecular weight of 496.45 g/mol. Its IUPAC name is N-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]-2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]acetamide.
| Compound Name | N-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]-2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 19524372 |
| Molecular Formula | C21H23F3N6O5 |
| Molecular Weight | 496.45 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | N-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]-2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | CCOc1ccc(Cn2cc(NC(=O)Cn3nc(C(F)(F)F)c([N+](=O)[O-])c3C)cn2)cc1OCC |
| InChI | InChI=1S/C21H23F3N6O5/c1-4-34-16-7-6-14(8-17(16)35-5-2)10-28-11-15(9-25-28)26-18(31)12-29-13(3)19(30(32)33)20(27-29)21(22,23)24/h6-9,11H,4-5,10,12H2,1-3H3,(H,26,31) |
| InChIKey | XUHUJCPQGUHVOR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 126.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|