C21H21ClN4O5 — CID 19338598
4-chloro-N-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]-3-nitrobenzamide (PubChem CID 19338598) has the molecular formula C21H21ClN4O5 and a molecular weight of 444.88 g/mol. Its IUPAC name is 4-chloro-N-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 19338598 |
| Molecular Formula | C21H21ClN4O5 |
| Molecular Weight | 444.88 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 4-chloro-N-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]-3-nitrobenzamide |
| SMILES | CCOc1ccc(Cn2cc(NC(=O)c3ccc(Cl)c([N+](=O)[O-])c3)cn2)cc1OCC |
| InChI | InChI=1S/C21H21ClN4O5/c1-3-30-19-8-5-14(9-20(19)31-4-2)12-25-13-16(11-23-25)24-21(27)15-6-7-17(22)18(10-15)26(28)29/h5-11,13H,3-4,12H2,1-2H3,(H,24,27) |
| InChIKey | VYHIGQIVAXFGAS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.88 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|