C21H22FN3O3 — CID 19336383
3,4-diethoxy-N-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]benzamide (PubChem CID 19336383) has the molecular formula C21H22FN3O3 and a molecular weight of 383.42 g/mol. Its IUPAC name is 3,4-diethoxy-N-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]benzamide.
| Compound Name | 3,4-diethoxy-N-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 19336383 |
| Molecular Formula | C21H22FN3O3 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 3,4-diethoxy-N-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]benzamide |
| SMILES | CCOc1ccc(C(=O)Nc2cnn(Cc3cccc(F)c3)c2)cc1OCC |
| InChI | InChI=1S/C21H22FN3O3/c1-3-27-19-9-8-16(11-20(19)28-4-2)21(26)24-18-12-23-25(14-18)13-15-6-5-7-17(22)10-15/h5-12,14H,3-4,13H2,1-2H3,(H,24,26) |
| InChIKey | ASUMDXQSAZOJLP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |