C21H21Cl2N3O3 — CID 19338545
2,3-dichloro-N-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]benzamide (PubChem CID 19338545) has the molecular formula C21H21Cl2N3O3 and a molecular weight of 434.32 g/mol. Its IUPAC name is 2,3-dichloro-N-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]benzamide.
| Compound Name | 2,3-dichloro-N-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 19338545 |
| Molecular Formula | C21H21Cl2N3O3 |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 2,3-dichloro-N-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]benzamide |
| SMILES | CCOc1ccc(Cn2cc(NC(=O)c3cccc(Cl)c3Cl)cn2)cc1OCC |
| InChI | InChI=1S/C21H21Cl2N3O3/c1-3-28-18-9-8-14(10-19(18)29-4-2)12-26-13-15(11-24-26)25-21(27)16-6-5-7-17(22)20(16)23/h5-11,13H,3-4,12H2,1-2H3,(H,25,27) |
| InChIKey | OBUVADBDGARENF-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |