C18H14Cl2N4O3 — CID 1223837
N-[1-[(3,4-dichlorophenyl)methyl]pyrazol-4-yl]-3-methyl-4-nitrobenzamide (PubChem CID 1223837) has the molecular formula C18H14Cl2N4O3 and a molecular weight of 405.24 g/mol. Its IUPAC name is N-[1-[(3,4-dichlorophenyl)methyl]pyrazol-4-yl]-3-methyl-4-nitrobenzamide.
| Compound Name | N-[1-[(3,4-dichlorophenyl)methyl]pyrazol-4-yl]-3-methyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 1223837 |
| Molecular Formula | C18H14Cl2N4O3 |
| Molecular Weight | 405.24 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | N-[1-[(3,4-dichlorophenyl)methyl]pyrazol-4-yl]-3-methyl-4-nitrobenzamide |
| SMILES | Cc1cc(C(=O)Nc2cnn(Cc3ccc(Cl)c(Cl)c3)c2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H14Cl2N4O3/c1-11-6-13(3-5-17(11)24(26)27)18(25)22-14-8-21-23(10-14)9-12-2-4-15(19)16(20)7-12/h2-8,10H,9H2,1H3,(H,22,25) |
| InChIKey | PKUUECNZECXSEO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.24 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|