C15H12Cl2N6O4 — CID 19511180
N-[1-[(3,4-dichlorophenyl)methyl]pyrazol-4-yl]-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide (PubChem CID 19511180) has the molecular formula C15H12Cl2N6O4 and a molecular weight of 411.21 g/mol. Its IUPAC name is N-[1-[(3,4-dichlorophenyl)methyl]pyrazol-4-yl]-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide.
| Compound Name | N-[1-[(3,4-dichlorophenyl)methyl]pyrazol-4-yl]-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19511180 |
| Molecular Formula | C15H12Cl2N6O4 |
| Molecular Weight | 411.21 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | N-[1-[(3,4-dichlorophenyl)methyl]pyrazol-4-yl]-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide |
| SMILES | COc1n[nH]c(C(=O)Nc2cnn(Cc3ccc(Cl)c(Cl)c3)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H12Cl2N6O4/c1-27-15-13(23(25)26)12(20-21-15)14(24)19-9-5-18-22(7-9)6-8-2-3-10(16)11(17)4-8/h2-5,7H,6H2,1H3,(H,19,24)(H,20,21) |
| InChIKey | LFUFQIPOLHAWCU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 127.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.21 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|