C15H13ClN6O4 — CID 19511020
N-[3-[(4-chloropyrazol-1-yl)methyl]phenyl]-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide (PubChem CID 19511020) has the molecular formula C15H13ClN6O4 and a molecular weight of 376.76 g/mol. Its IUPAC name is N-[3-[(4-chloropyrazol-1-yl)methyl]phenyl]-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide.
| Compound Name | N-[3-[(4-chloropyrazol-1-yl)methyl]phenyl]-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19511020 |
| Molecular Formula | C15H13ClN6O4 |
| Molecular Weight | 376.76 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | N-[3-[(4-chloropyrazol-1-yl)methyl]phenyl]-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide |
| SMILES | COc1n[nH]c(C(=O)Nc2cccc(Cn3cc(Cl)cn3)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H13ClN6O4/c1-26-15-13(22(24)25)12(19-20-15)14(23)18-11-4-2-3-9(5-11)7-21-8-10(16)6-17-21/h2-6,8H,7H2,1H3,(H,18,23)(H,19,20) |
| InChIKey | DNFNTDMTWHQLEE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 127.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.76 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|