C15H18N8O4 — CID 19511164
N-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide (PubChem CID 19511164) has the molecular formula C15H18N8O4 and a molecular weight of 374.36 g/mol. Its IUPAC name is N-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide.
| Compound Name | N-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19511164 |
| Molecular Formula | C15H18N8O4 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | N-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide |
| SMILES | CCn1ncc(Cn2cc(NC(=O)c3[nH]nc(OC)c3[N+](=O)[O-])cn2)c1C |
| InChI | InChI=1S/C15H18N8O4/c1-4-22-9(2)10(5-17-22)7-21-8-11(6-16-21)18-14(24)12-13(23(25)26)15(27-3)20-19-12/h5-6,8H,4,7H2,1-3H3,(H,18,24)(H,19,20) |
| InChIKey | BSUHRCRKOLEOHK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 145.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|