C17H22N8O3 — CID 19539280
N-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]-2-(5-methyl-4-nitropyrazol-1-yl)propanamide (PubChem CID 19539280) has the molecular formula C17H22N8O3 and a molecular weight of 386.42 g/mol. Its IUPAC name is N-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]-2-(5-methyl-4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]-2-(5-methyl-4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19539280 |
| Molecular Formula | C17H22N8O3 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]-2-(5-methyl-4-nitropyrazol-1-yl)propanamide |
| SMILES | CCn1ncc(Cn2cc(NC(=O)C(C)n3ncc([N+](=O)[O-])c3C)cn2)c1C |
| InChI | InChI=1S/C17H22N8O3/c1-5-23-11(2)14(6-19-23)9-22-10-15(7-18-22)21-17(26)13(4)24-12(3)16(8-20-24)25(27)28/h6-8,10,13H,5,9H2,1-4H3,(H,21,26) |
| InChIKey | DLJSERLYBBSQCD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 125.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|