C16H20N8O3 — CID 19476569
1-ethyl-N-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]-4-nitropyrazole-5-carboxamide (PubChem CID 19476569) has the molecular formula C16H20N8O3 and a molecular weight of 372.39 g/mol. Its IUPAC name is 1-ethyl-N-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]-4-nitropyrazole-5-carboxamide.
| Compound Name | 1-ethyl-N-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]-4-nitropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19476569 |
| Molecular Formula | C16H20N8O3 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 1-ethyl-N-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]-4-nitropyrazole-5-carboxamide |
| SMILES | CCn1ncc(Cn2cc(NC(=O)c3c([N+](=O)[O-])cnn3CC)cn2)c1C |
| InChI | InChI=1S/C16H20N8O3/c1-4-22-11(3)12(6-18-22)9-21-10-13(7-17-21)20-16(25)15-14(24(26)27)8-19-23(15)5-2/h6-8,10H,4-5,9H2,1-3H3,(H,20,25) |
| InChIKey | WCOWDTXCHIQRRP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 125.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|