C15H19N7O — CID 19475757
N-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]-2-methylpyrazole-3-carboxamide (PubChem CID 19475757) has the molecular formula C15H19N7O and a molecular weight of 313.37 g/mol. Its IUPAC name is N-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]-2-methylpyrazole-3-carboxamide.
| Compound Name | N-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]-2-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19475757 |
| Molecular Formula | C15H19N7O |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | N-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]-2-methylpyrazole-3-carboxamide |
| SMILES | CCn1ncc(Cn2cc(NC(=O)c3ccnn3C)cn2)c1C |
| InChI | InChI=1S/C15H19N7O/c1-4-22-11(2)12(7-18-22)9-21-10-13(8-17-21)19-15(23)14-5-6-16-20(14)3/h5-8,10H,4,9H2,1-3H3,(H,19,23) |
| InChIKey | LIAUBNTUGZIFCM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 82.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |