C21H28N10S — CID 19445910
1,3-bis[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]thiourea (PubChem CID 19445910) has the molecular formula C21H28N10S and a molecular weight of 452.59 g/mol. Its IUPAC name is 1,3-bis[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1,3-bis[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19445910 |
| Molecular Formula | C21H28N10S |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 1,3-bis[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]thiourea |
| SMILES | CCn1ncc(Cn2cc(NC(=S)Nc3cnn(Cc4cnn(CC)c4C)c3)cn2)c1C |
| InChI | InChI=1S/C21H28N10S/c1-5-30-15(3)17(7-24-30)11-28-13-19(9-22-28)26-21(32)27-20-10-23-29(14-20)12-18-8-25-31(6-2)16(18)4/h7-10,13-14H,5-6,11-12H2,1-4H3,(H2,26,27,32) |
| InChIKey | ZYXZOINLCYIXJS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|