C18H26N8S — CID 19334410
1-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]-3-[3-(3-methylpyrazol-1-yl)propyl]thiourea (PubChem CID 19334410) has the molecular formula C18H26N8S and a molecular weight of 386.53 g/mol. Its IUPAC name is 1-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]-3-[3-(3-methylpyrazol-1-yl)propyl]thiourea.
| Compound Name | 1-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]-3-[3-(3-methylpyrazol-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 19334410 |
| Molecular Formula | C18H26N8S |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 1-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]-3-[3-(3-methylpyrazol-1-yl)propyl]thiourea |
| SMILES | CCn1ncc(Cn2cc(NC(=S)NCCCn3ccc(C)n3)cn2)c1C |
| InChI | InChI=1S/C18H26N8S/c1-4-26-15(3)16(10-21-26)12-25-13-17(11-20-25)22-18(27)19-7-5-8-24-9-6-14(2)23-24/h6,9-11,13H,4-5,7-8,12H2,1-3H3,(H2,19,22,27) |
| InChIKey | YFSKYGKGCHRTQX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|