C18H19Cl3N6S — CID 19573232
1-[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]-3-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]thiourea (PubChem CID 19573232) has the molecular formula C18H19Cl3N6S and a molecular weight of 457.82 g/mol. Its IUPAC name is 1-[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]-3-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]thiourea.
| Compound Name | 1-[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]-3-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 19573232 |
| Molecular Formula | C18H19Cl3N6S |
| Molecular Weight | 457.82 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | 1-[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]-3-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]thiourea |
| SMILES | Cc1nn(CCCNC(=S)Nc2cnn(Cc3ccccc3Cl)c2)c(Cl)c1Cl |
| InChI | InChI=1S/C18H19Cl3N6S/c1-12-16(20)17(21)27(25-12)8-4-7-22-18(28)24-14-9-23-26(11-14)10-13-5-2-3-6-15(13)19/h2-3,5-6,9,11H,4,7-8,10H2,1H3,(H2,22,24,28) |
| InChIKey | JVWNPZSTTARQMA-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.82 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|