C19H19Cl2F3N6S — CID 19334230
1-[1-[(2,4-dichlorophenyl)methyl]pyrazol-4-yl]-3-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]thiourea (PubChem CID 19334230) has the molecular formula C19H19Cl2F3N6S and a molecular weight of 491.37 g/mol. Its IUPAC name is 1-[1-[(2,4-dichlorophenyl)methyl]pyrazol-4-yl]-3-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]thiourea.
| Compound Name | 1-[1-[(2,4-dichlorophenyl)methyl]pyrazol-4-yl]-3-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]thiourea |
|---|---|
| PubChem CID | 19334230 |
| Molecular Formula | C19H19Cl2F3N6S |
| Molecular Weight | 491.37 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | 1-[1-[(2,4-dichlorophenyl)methyl]pyrazol-4-yl]-3-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]thiourea |
| SMILES | Cc1cc(C(F)(F)F)nn1CCCNC(=S)Nc1cnn(Cc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C19H19Cl2F3N6S/c1-12-7-17(19(22,23)24)28-30(12)6-2-5-25-18(31)27-15-9-26-29(11-15)10-13-3-4-14(20)8-16(13)21/h3-4,7-9,11H,2,5-6,10H2,1H3,(H2,25,27,31) |
| InChIKey | XCVXKGHEAKSSGU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.37 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|