C15H15F5N4S — CID 17266651
1-(2,4-difluorophenyl)-3-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]thiourea (PubChem CID 17266651) has the molecular formula C15H15F5N4S and a molecular weight of 378.37 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]thiourea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]thiourea |
|---|---|
| PubChem CID | 17266651 |
| Molecular Formula | C15H15F5N4S |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]thiourea |
| SMILES | Cc1cc(C(F)(F)F)nn1CCCNC(=S)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C15H15F5N4S/c1-9-7-13(15(18,19)20)23-24(9)6-2-5-21-14(25)22-12-4-3-10(16)8-11(12)17/h3-4,7-8H,2,5-6H2,1H3,(H2,21,22,25) |
| InChIKey | KKGTUYCTVJGMGF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|