C17H19F5N4OS — CID 19334227
1-[2-(difluoromethoxy)-4-methylphenyl]-3-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]thiourea (PubChem CID 19334227) has the molecular formula C17H19F5N4OS and a molecular weight of 422.42 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)-4-methylphenyl]-3-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]thiourea.
| Compound Name | 1-[2-(difluoromethoxy)-4-methylphenyl]-3-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]thiourea |
|---|---|
| PubChem CID | 19334227 |
| Molecular Formula | C17H19F5N4OS |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 1-[2-(difluoromethoxy)-4-methylphenyl]-3-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]thiourea |
| SMILES | Cc1ccc(NC(=S)NCCCn2nc(C(F)(F)F)cc2C)c(OC(F)F)c1 |
| InChI | InChI=1S/C17H19F5N4OS/c1-10-4-5-12(13(8-10)27-15(18)19)24-16(28)23-6-3-7-26-11(2)9-14(25-26)17(20,21)22/h4-5,8-9,15H,3,6-7H2,1-2H3,(H2,23,24,28) |
| InChIKey | VKMLJSDLZQFNKK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|