C14H16F2N4O2S — CID 19445654
1-[2-(difluoromethoxy)-4-methylphenyl]-3-[1-(methoxymethyl)pyrazol-4-yl]thiourea (PubChem CID 19445654) has the molecular formula C14H16F2N4O2S and a molecular weight of 342.37 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)-4-methylphenyl]-3-[1-(methoxymethyl)pyrazol-4-yl]thiourea.
| Compound Name | 1-[2-(difluoromethoxy)-4-methylphenyl]-3-[1-(methoxymethyl)pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19445654 |
| Molecular Formula | C14H16F2N4O2S |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 1-[2-(difluoromethoxy)-4-methylphenyl]-3-[1-(methoxymethyl)pyrazol-4-yl]thiourea |
| SMILES | COCn1cc(NC(=S)Nc2ccc(C)cc2OC(F)F)cn1 |
| InChI | InChI=1S/C14H16F2N4O2S/c1-9-3-4-11(12(5-9)22-13(15)16)19-14(23)18-10-6-17-20(7-10)8-21-2/h3-7,13H,8H2,1-2H3,(H2,18,19,23) |
| InChIKey | GNQGLTDGBOVBEW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 60.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|