C15H18F2N4O2S — CID 19445961
1-[2-(difluoromethoxy)-5-methylphenyl]-3-[1-(ethoxymethyl)pyrazol-4-yl]thiourea (PubChem CID 19445961) has the molecular formula C15H18F2N4O2S and a molecular weight of 356.40 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)-5-methylphenyl]-3-[1-(ethoxymethyl)pyrazol-4-yl]thiourea.
| Compound Name | 1-[2-(difluoromethoxy)-5-methylphenyl]-3-[1-(ethoxymethyl)pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19445961 |
| Molecular Formula | C15H18F2N4O2S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 1-[2-(difluoromethoxy)-5-methylphenyl]-3-[1-(ethoxymethyl)pyrazol-4-yl]thiourea |
| SMILES | CCOCn1cc(NC(=S)Nc2cc(C)ccc2OC(F)F)cn1 |
| InChI | InChI=1S/C15H18F2N4O2S/c1-3-22-9-21-8-11(7-18-21)19-15(24)20-12-6-10(2)4-5-13(12)23-14(16)17/h4-8,14H,3,9H2,1-2H3,(H2,19,20,24) |
| InChIKey | JATQZWXIYRAEQR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 60.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|