C17H18F2N2OS — CID 17284915
1-[2-(difluoromethoxy)-4-methylphenyl]-3-(2,5-dimethylphenyl)thiourea (PubChem CID 17284915) has the molecular formula C17H18F2N2OS and a molecular weight of 336.41 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)-4-methylphenyl]-3-(2,5-dimethylphenyl)thiourea.
| Compound Name | 1-[2-(difluoromethoxy)-4-methylphenyl]-3-(2,5-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 17284915 |
| Molecular Formula | C17H18F2N2OS |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 1-[2-(difluoromethoxy)-4-methylphenyl]-3-(2,5-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(C)c(NC(=S)Nc2ccc(C)cc2OC(F)F)c1 |
| InChI | InChI=1S/C17H18F2N2OS/c1-10-4-6-12(3)14(8-10)21-17(23)20-13-7-5-11(2)9-15(13)22-16(18)19/h4-9,16H,1-3H3,(H2,20,21,23) |
| InChIKey | MHEZDMCWCFNMJZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|