C20H18Cl2F2N4OS — CID 19403624
1-[1-[(2,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-[2-(difluoromethoxy)-4-methylphenyl]thiourea (PubChem CID 19403624) has the molecular formula C20H18Cl2F2N4OS and a molecular weight of 471.36 g/mol. Its IUPAC name is 1-[1-[(2,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-[2-(difluoromethoxy)-4-methylphenyl]thiourea.
| Compound Name | 1-[1-[(2,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-[2-(difluoromethoxy)-4-methylphenyl]thiourea |
|---|---|
| PubChem CID | 19403624 |
| Molecular Formula | C20H18Cl2F2N4OS |
| Molecular Weight | 471.36 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | 1-[1-[(2,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-[2-(difluoromethoxy)-4-methylphenyl]thiourea |
| SMILES | Cc1ccc(NC(=S)Nc2cc(C)n(Cc3ccc(Cl)cc3Cl)n2)c(OC(F)F)c1 |
| InChI | InChI=1S/C20H18Cl2F2N4OS/c1-11-3-6-16(17(7-11)29-19(23)24)25-20(30)26-18-8-12(2)28(27-18)10-13-4-5-14(21)9-15(13)22/h3-9,19H,10H2,1-2H3,(H2,25,26,27,30) |
| InChIKey | XSMCUANFMWIENU-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.36 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|