C19H15BrClF3N4OS — CID 19397135
1-[4-bromo-1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-[2-(difluoromethoxy)-4-methylphenyl]thiourea (PubChem CID 19397135) has the molecular formula C19H15BrClF3N4OS and a molecular weight of 519.77 g/mol. Its IUPAC name is 1-[4-bromo-1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-[2-(difluoromethoxy)-4-methylphenyl]thiourea.
| Compound Name | 1-[4-bromo-1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-[2-(difluoromethoxy)-4-methylphenyl]thiourea |
|---|---|
| PubChem CID | 19397135 |
| Molecular Formula | C19H15BrClF3N4OS |
| Molecular Weight | 519.77 g/mol |
| Exact Mass | 517.98 |
| IUPAC Name | 1-[4-bromo-1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-[2-(difluoromethoxy)-4-methylphenyl]thiourea |
| SMILES | Cc1ccc(NC(=S)Nc2nn(Cc3c(F)cccc3Cl)cc2Br)c(OC(F)F)c1 |
| InChI | InChI=1S/C19H15BrClF3N4OS/c1-10-5-6-15(16(7-10)29-18(23)24)25-19(30)26-17-12(20)9-28(27-17)8-11-13(21)3-2-4-14(11)22/h2-7,9,18H,8H2,1H3,(H2,25,26,27,30) |
| InChIKey | XBQBXZWRECLYJQ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.77 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|