C16H13BrClFN4OS — CID 19397094
1-[4-bromo-1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-(furan-2-ylmethyl)thiourea (PubChem CID 19397094) has the molecular formula C16H13BrClFN4OS and a molecular weight of 443.73 g/mol. Its IUPAC name is 1-[4-bromo-1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-[4-bromo-1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 19397094 |
| Molecular Formula | C16H13BrClFN4OS |
| Molecular Weight | 443.73 g/mol |
| Exact Mass | 441.97 |
| IUPAC Name | 1-[4-bromo-1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-(furan-2-ylmethyl)thiourea |
| SMILES | Fc1cccc(Cl)c1Cn1cc(Br)c(NC(=S)NCc2ccco2)n1 |
| InChI | InChI=1S/C16H13BrClFN4OS/c17-12-9-23(8-11-13(18)4-1-5-14(11)19)22-15(12)21-16(25)20-7-10-3-2-6-24-10/h1-6,9H,7-8H2,(H2,20,21,22,25) |
| InChIKey | ZKVXYYQUQFRDKX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 55.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.73 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|