C14H15Cl2FN4OS — CID 17374630
1-[4-chloro-1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-(2-methoxyethyl)thiourea (PubChem CID 17374630) has the molecular formula C14H15Cl2FN4OS and a molecular weight of 377.27 g/mol. Its IUPAC name is 1-[4-chloro-1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-[4-chloro-1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 17374630 |
| Molecular Formula | C14H15Cl2FN4OS |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 1-[4-chloro-1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-(2-methoxyethyl)thiourea |
| SMILES | COCCNC(=S)Nc1nn(Cc2c(F)cccc2Cl)cc1Cl |
| InChI | InChI=1S/C14H15Cl2FN4OS/c1-22-6-5-18-14(23)19-13-11(16)8-21(20-13)7-9-10(15)3-2-4-12(9)17/h2-4,8H,5-7H2,1H3,(H2,18,19,20,23) |
| InChIKey | NABPORLRWPPMHR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|