C15H18Cl2N4OS — CID 19397226
1-[4-chloro-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-(3-methoxypropyl)thiourea (PubChem CID 19397226) has the molecular formula C15H18Cl2N4OS and a molecular weight of 373.31 g/mol. Its IUPAC name is 1-[4-chloro-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-(3-methoxypropyl)thiourea.
| Compound Name | 1-[4-chloro-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-(3-methoxypropyl)thiourea |
|---|---|
| PubChem CID | 19397226 |
| Molecular Formula | C15H18Cl2N4OS |
| Molecular Weight | 373.31 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 1-[4-chloro-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-(3-methoxypropyl)thiourea |
| SMILES | COCCCNC(=S)Nc1nn(Cc2ccccc2Cl)cc1Cl |
| InChI | InChI=1S/C15H18Cl2N4OS/c1-22-8-4-7-18-15(23)19-14-13(17)10-21(20-14)9-11-5-2-3-6-12(11)16/h2-3,5-6,10H,4,7-9H2,1H3,(H2,18,19,20,23) |
| InChIKey | SSTINDCYNJJICN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|