C18H25ClFN5S — CID 19403388
1-[4-chloro-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-[3-(diethylamino)propyl]thiourea (PubChem CID 19403388) has the molecular formula C18H25ClFN5S and a molecular weight of 397.95 g/mol. Its IUPAC name is 1-[4-chloro-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-[3-(diethylamino)propyl]thiourea.
| Compound Name | 1-[4-chloro-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-[3-(diethylamino)propyl]thiourea |
|---|---|
| PubChem CID | 19403388 |
| Molecular Formula | C18H25ClFN5S |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 1-[4-chloro-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-[3-(diethylamino)propyl]thiourea |
| SMILES | CCN(CC)CCCNC(=S)Nc1nn(Cc2ccccc2F)cc1Cl |
| InChI | InChI=1S/C18H25ClFN5S/c1-3-24(4-2)11-7-10-21-18(26)22-17-15(19)13-25(23-17)12-14-8-5-6-9-16(14)20/h5-6,8-9,13H,3-4,7,10-12H2,1-2H3,(H2,21,22,23,26) |
| InChIKey | GUHVBZUJUJXPJV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 45.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|