C19H18Cl2N4S — CID 19401468
1-[4-chloro-1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-3-(2-phenylethyl)thiourea (PubChem CID 19401468) has the molecular formula C19H18Cl2N4S and a molecular weight of 405.35 g/mol. Its IUPAC name is 1-[4-chloro-1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-3-(2-phenylethyl)thiourea.
| Compound Name | 1-[4-chloro-1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-3-(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 19401468 |
| Molecular Formula | C19H18Cl2N4S |
| Molecular Weight | 405.35 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 1-[4-chloro-1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-3-(2-phenylethyl)thiourea |
| SMILES | S=C(NCCc1ccccc1)Nc1nn(Cc2ccc(Cl)cc2)cc1Cl |
| InChI | InChI=1S/C19H18Cl2N4S/c20-16-8-6-15(7-9-16)12-25-13-17(21)18(24-25)23-19(26)22-11-10-14-4-2-1-3-5-14/h1-9,13H,10-12H2,(H2,22,23,24,26) |
| InChIKey | ZKXODFIHGSXOJR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.35 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|