C17H15ClN4S — CID 19399488
1-(1-benzyl-4-chloropyrazol-3-yl)-3-phenylthiourea (PubChem CID 19399488) has the molecular formula C17H15ClN4S and a molecular weight of 342.86 g/mol. Its IUPAC name is 1-(1-benzyl-4-chloropyrazol-3-yl)-3-phenylthiourea.
| Compound Name | 1-(1-benzyl-4-chloropyrazol-3-yl)-3-phenylthiourea |
|---|---|
| PubChem CID | 19399488 |
| Molecular Formula | C17H15ClN4S |
| Molecular Weight | 342.86 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 1-(1-benzyl-4-chloropyrazol-3-yl)-3-phenylthiourea |
| SMILES | S=C(Nc1ccccc1)Nc1nn(Cc2ccccc2)cc1Cl |
| InChI | InChI=1S/C17H15ClN4S/c18-15-12-22(11-13-7-3-1-4-8-13)21-16(15)20-17(23)19-14-9-5-2-6-10-14/h1-10,12H,11H2,(H2,19,20,21,23) |
| InChIKey | CPUUJYSAJOQRDK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.86 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|