C18H17ClN4S — CID 19399501
1-(1-benzyl-4-chloropyrazol-3-yl)-3-(2-methylphenyl)thiourea (PubChem CID 19399501) has the molecular formula C18H17ClN4S and a molecular weight of 356.88 g/mol. Its IUPAC name is 1-(1-benzyl-4-chloropyrazol-3-yl)-3-(2-methylphenyl)thiourea.
| Compound Name | 1-(1-benzyl-4-chloropyrazol-3-yl)-3-(2-methylphenyl)thiourea |
|---|---|
| PubChem CID | 19399501 |
| Molecular Formula | C18H17ClN4S |
| Molecular Weight | 356.88 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 1-(1-benzyl-4-chloropyrazol-3-yl)-3-(2-methylphenyl)thiourea |
| SMILES | Cc1ccccc1NC(=S)Nc1nn(Cc2ccccc2)cc1Cl |
| InChI | InChI=1S/C18H17ClN4S/c1-13-7-5-6-10-16(13)20-18(24)21-17-15(19)12-23(22-17)11-14-8-3-2-4-9-14/h2-10,12H,11H2,1H3,(H2,20,21,22,24) |
| InChIKey | IIGAITHQJVSPKJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.88 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|