C19H18ClFN4S — CID 19401220
1-[4-chloro-1-[(3-fluorophenyl)methyl]pyrazol-3-yl]-3-(2,4-dimethylphenyl)thiourea (PubChem CID 19401220) has the molecular formula C19H18ClFN4S and a molecular weight of 388.90 g/mol. Its IUPAC name is 1-[4-chloro-1-[(3-fluorophenyl)methyl]pyrazol-3-yl]-3-(2,4-dimethylphenyl)thiourea.
| Compound Name | 1-[4-chloro-1-[(3-fluorophenyl)methyl]pyrazol-3-yl]-3-(2,4-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 19401220 |
| Molecular Formula | C19H18ClFN4S |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 1-[4-chloro-1-[(3-fluorophenyl)methyl]pyrazol-3-yl]-3-(2,4-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)Nc2nn(Cc3cccc(F)c3)cc2Cl)c(C)c1 |
| InChI | InChI=1S/C19H18ClFN4S/c1-12-6-7-17(13(2)8-12)22-19(26)23-18-16(20)11-25(24-18)10-14-4-3-5-15(21)9-14/h3-9,11H,10H2,1-2H3,(H2,22,23,24,26) |
| InChIKey | QEHUIAADBJQFNL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|