C17H18ClFN6S — CID 19401246
1-[4-chloro-1-[(3-fluorophenyl)methyl]pyrazol-3-yl]-3-[(1-ethylpyrazol-4-yl)methyl]thiourea (PubChem CID 19401246) has the molecular formula C17H18ClFN6S and a molecular weight of 392.89 g/mol. Its IUPAC name is 1-[4-chloro-1-[(3-fluorophenyl)methyl]pyrazol-3-yl]-3-[(1-ethylpyrazol-4-yl)methyl]thiourea.
| Compound Name | 1-[4-chloro-1-[(3-fluorophenyl)methyl]pyrazol-3-yl]-3-[(1-ethylpyrazol-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 19401246 |
| Molecular Formula | C17H18ClFN6S |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 1-[4-chloro-1-[(3-fluorophenyl)methyl]pyrazol-3-yl]-3-[(1-ethylpyrazol-4-yl)methyl]thiourea |
| SMILES | CCn1cc(CNC(=S)Nc2nn(Cc3cccc(F)c3)cc2Cl)cn1 |
| InChI | InChI=1S/C17H18ClFN6S/c1-2-24-10-13(8-21-24)7-20-17(26)22-16-15(18)11-25(23-16)9-12-4-3-5-14(19)6-12/h3-6,8,10-11H,2,7,9H2,1H3,(H2,20,22,23,26) |
| InChIKey | RYBYARRXMAXWJN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|