C21H15Cl3N4S — CID 19399245
1-[4-chloro-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-naphthalen-1-ylthiourea (PubChem CID 19399245) has the molecular formula C21H15Cl3N4S and a molecular weight of 461.81 g/mol. Its IUPAC name is 1-[4-chloro-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-naphthalen-1-ylthiourea.
| Compound Name | 1-[4-chloro-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-naphthalen-1-ylthiourea |
|---|---|
| PubChem CID | 19399245 |
| Molecular Formula | C21H15Cl3N4S |
| Molecular Weight | 461.81 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | 1-[4-chloro-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-naphthalen-1-ylthiourea |
| SMILES | S=C(Nc1nn(Cc2ccc(Cl)c(Cl)c2)cc1Cl)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C21H15Cl3N4S/c22-16-9-8-13(10-17(16)23)11-28-12-18(24)20(27-28)26-21(29)25-19-7-3-5-14-4-1-2-6-15(14)19/h1-10,12H,11H2,(H2,25,26,27,29) |
| InChIKey | HSBKCWMKJMFFMU-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.81 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|